Home > Keywords >
| Catalog | name | Description | price |
|---|---|---|---|
| R-C-6426 | DSPE-PEG2000-ANTPCGPYTHDCPVKR | DSPE-PEG-ANTPCGPYTHDCPVKR,DSPE(1,2-distearoyl-sn-glycero-3-phosphoethanolamine)is a phospholipid that is often employed as a component in the formulation of liposomes and other lipid-based drug delivery systems.PEG is often used in drug delivery to enhance drug circulation time and reduce nonspecific interactions,thereby potentially improving the bioavailability of the delivered drug.This DSPE-PEG can couple peptides and other functional groups,such as ANTPCGPYTHDCPVKR,etc. | price> |
| R-M-W07 | Spirotetramat Metabolite BYI08330-cis-enol,cas:203312-38-3 | Spirotetramat Metabolite BYI08330-cis-enol(CAS:203312-38-3) is a metabolite.And can be used as analyte in analytical and biological studies for multi-residue method for determination of pesticides and pesticide metabolites in honeybees by liquid and gas chromatography coupled with tandem mass spectrometry, used to investigate honeybee poisoning incidents. | price> |
| R-C-6427 | DOPE-PEG2K-4-Amino-TEMPO | DOPE-PEG-4-Amino-TEMPO,DOPE-PEG2K-4-Amino-TEMPO is a molecular construct used in the field of nanomedicine and drug delivery.DOPE (1,2-dioleoyl-sn-glycero-3-phosphoethanolamine)is a type of phospholipid commonly used in the formulation of liposomes and other lipid-based drug delivery systems.PEG is a hydrophilic polymer frequently used in drug delivery to improve circulation time and reduce immunogenicity.4-Amino-TEMPO is a stable free radical compound that is often used as a chemical modifier or in various chemical reactions. | price> |
| R-M-W08 | 5-Hydroxythiabendazole,cas:948-71-0 | 5-Hydroxy Thiabendazole is a major metabolite of Thiabendazole. | price> |
| R-C-6428 | DPPS-PEG2000-NH2 | DPPS-PEG-NH2,DPPS-PEG-Amine,DPPS-PEG-NH2 is a molecular construct used in the field of nanomedicine and drug delivery.DPPS (1,2-dipalmitoyl-sn-glycero-3-phospho-L-serine) is a phospholipid that can form lipid bilayers and is often used in the design of liposomes and lipid-based drug delivery systems.PEG is a hydrophilic polymer commonly used in drug delivery systems to improve circulation time and reduce immunogenicity.DPPS-PEG-NH2 forms a complex designed for the targeted delivery of drugs, imaging agents, or other compounds to specific tissues or cells,potentially enhancing their pharmacokinetics and therapeutic effects. | price> |
| R-M-W09 | 5-hydroxy-thiabendazolesulfate,cas:962-28-7 | 5-Hydroxy ThiabendazoleSulfate is a sulfate metabolite of Thiabendazole. | price> |
| R-C-6429 | N3-PyTPE | TPE-Py-N3,TPE-PyN3,Aggregation induced emission(AlE)is a non luminescent biomolecule that exists in the form of a single molecule in solution.As the solvent gradually evaporates,the fluorescence gradually increases.Tetrastyrene is an important class of aggregated luminescent fluorescent dyes.When the tetrastyrene molecule is in an aggregated or solid state,the rotation within the molecule is restricted.Non radiative channel forbidden excited molecules emit photons back to the ground state. | price> |
| R-C-6430 | PLL30-Mannose | Mannose is a simple sugar,is recognized by mannose receptors that are present on the surface of specific immune cells,particularly macrophages.By conjugating mannose to poly(L-lysine),the resulting construct can potentially target cells that express mannose receptors,such as certain types of immune cells. | price> |
| R-C-6431 | Customized synthesis of acryloyl-CD | Custom synthesis of acryloyl-cyclodextrin typically involves the introduction of an acryloyl functional group to the molecular structure of cyclodextrin.Cyclodextrins are a family of cyclic oligosaccharides, which consist of (α-1,4)-linked glucopyranose subunits.They are known for their ability to form inclusion complexes with a variety of molecules,which can be useful for increasing the solubility and stability of drugs and for other pharmaceutical and industrial applications. | price> |
| R-C-6432 | DSPE-PEG2000-TK-PEI1800 | DSPE-PEG-TK-PEI,DSPE is the lipophilic part that anchors the molecule into liposomal or other lipid-based carriers,PEG serves as a hydrophilic linker,and PEI is the terminal part that may be used for binding and condensing nucleic acids for gene delivery.This kind of molecule could have potential applications in the delivery of genetic material to cells. | price> |
| R-C-6433 | POLY(VINYL ALCOHOL)-B-POLY(2-VINYL PYRIDINE) | Poly(vinyl alcohol)-b-poly(2-vinyl pyridine)is a block copolymer consisting of a poly(vinyl alcohol)(PVA) segment linked to a poly(2-vinyl pyridine)(P2VP)segment.This type of copolymer can exhibit amphiphilic properties due to the contrast between the hydrophilic nature of poly(vinyl alcohol) and the relatively hydrophobic nature of poly(2-vinyl pyridine). | price> |
| R-C-6434 | POLY(VINYL ALCOHOL)-B-POLY(STYRENE) | Poly(vinyl alcohol)-b-poly(styrene)is a block copolymer that contains two distinct polymer segments.poly(vinyl alcohol) (PVA),is hydrophilic,poly(styrene),is hydrophobic.These copolymers can self-assemble into various structures,depending on their composition and the surrounding conditions. | price> |
| R-C-6435 | POLY(VINYL ALCOHOL)-B-POLY(METHYL METHACRYLATE) | PVA-b-PMMA,PVA is a synthetic polymer that is soluble in water, has good film-forming, emulsifying, and adhesive properties. It is non-toxic, biodegradable under certain conditions, and resistant to oils and greases.PMMA is a transparent thermoplastic often used as a lightweight or shatter-resistant alternative to glass. | price> |
| R-C-6436 | DSPE-PEG2000-YTIWMPENPRPGTPCDIFTNSRGKRASNGC-FITC | Such a molecular construct would be used in biomedical applications,potentially for the targeted delivery of drugs where the DSPE embeds the complex into liposome nanoparticles,the PEG2000 provides aqueous stability and stealth,the peptide mediates targeting,and the FITC allows for imaging and tracking of the delivery system.This setup would allow for the therapeutic payload to be delivered to a specific site while minimizing side effects and maximizing treatment efficacy. | price> |
| R-C-6437 | POLY(VINYL ALCOHOL)-B-POLY(4-HYDROXYSTYRENE) | Poly(vinyl alcohol)-b-poly(4-hydroxystyrene)is a block copolymer consisting of a poly(vinyl alcohol)(PVA) segment linked to a poly(4-hydroxystyrene)(PHS)segment.PHS is a derivative of styrene containing a hydroxyl group.This type of copolymer can exhibit amphiphilic properties due to the contrast between the hydrophilic nature of poly(vinyl alcohol)and the relatively hydrophobic nature of poly(4-hydroxystyrene). | price> |
| R-C-6438 | POLY(VINYL ACETATE)-B-POLY(N-VINYL PYRROLIDONE) | Poly(vinyl acetate)-b-poly(N-vinyl pyrrolidone)is a block copolymer consisting of a poly(vinyl acetate)(PVAc)segment linked to a poly(N-vinyl pyrrolidone)(PVP)segment.The poly(vinyl acetate) segment is hydrophobic,while the poly(N-vinyl pyrrolidone)segment is hydrophilic. | price> |
| R-C-6439 | POLY(VINYL ACETATE)-B-POLY(ACRYLIC ACID) | Poly(vinyl acetate)-b-poly(acrylic acid)is a type of block copolymer containing two distinct polymer segments.The first segment,poly(vinyl acetate)(PVAc),is hydrophobic,while the second segment,poly(acrylic acid)(PAA),is hydrophilic due to the presence of carboxylic acid groups along the polymer chain.The copolymer,depending on its composition and environmental conditions,can form various structures,such as micelles or vesicles,due to the self-assembly behavior driven by the contrast between its hydrophobic and hydrophilic components. | price> |
| R-C-6440 | DSPE-TK-PEG2K-LSALTPSPSWLKYKAL | DSPE-TK-PEG-LSALTPSPSWLKYKAL,DSPE would anchor the construct within a lipid bilayer of a liposome,the PEG would extend out from the surface,providing water solubility and biocompatibility,and the peptide sequence would be presented on the exterior for interaction with specific cellular targets.The thioketal(TK) component would be part of the linker that holds these units together. | price> |
| R-C-6441 | DSPE-PEG2000-CSTSMLK(Ac)AC | DSPE-PEG-CSTSMLK(Ac)AC,The DSPE moiety serves as the lipid-soluble part that can be used to integrate this molecule into a liposomal or micelle structure.The PEG segment confers hydrophilicity and stealth properties to improve the pharmacokinetic profile of the liposome or drug delivery system.The peptide CSTSMLK(Ac)AC is likely to have a specific biological function or targeting capability.The modification of lysine with an acetyl group could be crucial for the peptides activity or its stability. | price> |
| R-C-6442 | DSPE-PEG2000-SNDRPPNILQKR | DSPE-PEG-SNDRPPNILQKR,DSPE can contribute to the stability of these particles and extend their circulation time in the bloodstream.PEG (Polyethylene Glycol)is a hydrophilic polymer that,when conjugated to drugs or other molecules,tends to improve their solubility and decrease immunogenicity.and the peptide sequence grants specificity for a certain biological target,such as a type of cell,protein receptor,or microenvironment. | price> |

Items-$0.00

Email:
Tel.:
RuixiBiotechCo.Ltd /KamulinBiotechco.ltd
Add: Room 20F 2002, Meiyuan Building, Yanta District, Xi’ an City, Shaanxi Province 710061 China
Tel: 02988811435
Fax: (86-29)8881-1435
Email: sales@ruixibiotech.com
Web: http://www.ruixibiotech.com


